raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 26+ )
Otras preguntas
4 Complete the sentences with the correct form of an appropriate verb. (6) 1 Protesters angrily slogans at the president's car as it raced past on the way to th
the question is there
What would happen if all autotrophs died?
what is this trying to bring my grades up pls help
Combine these two sentences with a conjunction (and, or, but): 1. He had to get up early in the morning to go to work. 2. He went to the party, anyway.
1. "Musée des Beaux Arts" Lines 14-17: How do Ovid and Auden differ in their idea of how the ploughman will react to Daedalus and Icarus? What does this show us
Shirts at A water park come in green or yellow they come in small or large they also have short Sleeves oat long sleeves how many Combinations of different colo
Which of the following is NOT a characteristic of population? O The people in the group being investigated O The group from which the sample comes O The people
WILL MARK BRANILIEST PLZ HELP Type the correct answer in the box. Use numerals instead of words, and round your answer to the nearest whole number. Meghan flipp
Which word is the antecedent in the sentence below? Bandit pawed at the toilet's heavy lid as if to say, "Please open it." Group of answer choices toilet say
