kaylahocean kaylahocean

03-02-2021
Mathematics

contestada

Write the ordered pair that best describes point P. help please

Write the ordered pair that best describes point P help please class=

Respuesta :

Darey388 Darey388

03-02-2021

Answer: (0,3) I don’t see any numbers on the y or x-axis so I’m guessing it goes by 1’s

Step-by-step explanation:

Answer Link

Otras preguntas

Choose one property of water that makes it unique describe the property and explain the chemical or physical reasons that causes water to have to property.

Describe the reasons the United States became more industrialized after the Civil War. How did the development of railroads lead to the growth of other industri

Find the midpoint of the segment with the following endpoint (−4,−4) and (−9,5)

What do we call the experimental apparatus that William crooks used in his experiments and what did he discover

If someone throws a 3 gram fry accelerating at 5 meter/second2, what is the fry’s force?

H2SO4+2NaOH=Na2SO4+2H20 NAME THE SALT PRODUCED?

cosec(6b+pi/8)=sec(2b-pi/8)

What would I got if I divide 0 by 0. some people says that the result can be any numbers since 0/0 = x...........x can be any number 0=x.0 0 =0

Your grandmother deposited some money on your saving account several years ago. If after 4 years, you had $489 and after 6 years, you had $567 on your account.

Based on Megan’s attempts in Questions 1-4, what might be a good ratio of fruit punch to ginger ale?